Why benzophenone does not give aldol condensation?
Since benzophenone lacs that [math]\alpha -hydrogen[/math] atom, it doesn’t undergo aldol condensation reaction. In case of Cannizzaro reaction, we need Hydrogen attached to the carbonyl carbon, which is also absent in benzophenone as it is a ketone. So it also doesn’t undergo Cannizzaro reaction.
Which does not undergo aldol condensation reaction?
The carbonyl compounds must contain an α− hydrogen atom to undergo aldol condensation. Thus, propanal and ethanal are the aldehydes that can undergo aldol condensation. Thus, aldehydes that do not undergo aldol condensation are trichloroethanal, benzaldehyde and methanal.
Is benzophenone a carbonyl compound?
Acetophenone and benzophenone both are carbonyl compounds.
What is the Iupac name of benzophenone?
diphenylmethanone
| IUPAC Name | diphenylmethanone |
|---|---|
| Alternative Names | BENZOPHENONE diphenylmethanone Diphenyl ketone |
| Molecular Formula | C13H10O |
| Molar Mass | 182.222 g/mol |
| InChI | InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
Can Methanal undergo aldol condensation?
Methanol does not give aldol condensation because only those compounds which have α-hydrogen atoms can undergo aldol reaction ethanol pessess α-hydrogen and undergoes aldol condensation Methanal has no alpha hydrogen atoms hence does not undergo aldol condensation.
Which of the following do not give aldol condensation reaction Mcq?
Aldehydes that do not have α-hydrogen undergo aldol condensation.
Does benzaldehyde undergo cannizaro?
Benzaldehyde has no α-hydrogens, so it will undergo the Cannizzaro reaction.
Why benzaldehyde has no alpha hydrogen?
Organic compounds which have formyl group ( R−O||C−H )attached to them are termed as Aldehyde. In case of benzaldehyde the alpha carbon atom has no hydrogen atoms attached hence there is no alpha hydrogen present in benzaldehyde. Due to the absence of alpha hydrogen it also cannot undergo aldol condensation.
Why is benzophenone insoluble in water?
Benzophenone was insoluble in water as it is nonpolar while water is highly polar. Methyl alcohol is polar but not as much as water. Thus, the nonpolar benzophenone was soluble in methyl alcohol. Benzophenone was partially soluble in hexane because hexane is nonpolar as is benzophenone.
Why is benzophenone soluble in methanol?
Methanol has an intermediate polarity; however, it can dissolve benzophenone because the polar carbonyl group on benzophenone can make hydrogen bond to the methanol; therefore, making benzophenone soluble in methanol.
Why benzophenone is not soluble in water?
Benzophenone is insoluble in water because water is a polar solvent. The polarity of methyl alcohol lies somewhere between polar and non-polar.